CAS No. 960-71-4
For more details check the specification page: Triphenylborane
Chemical identifiers
| Linear formula | (C6H5)3B |
| Pubchem CID | 70400 |
| SMILES | B(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
| IUPAC Name | triphenylborane |
| InchI Identifier | InChI=1S/C18H15B/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
| InchI Key | MXSVLWZRHLXFKH-UHFFFAOYSA-N |
Safety information
| UN | 2926 |
| Hazardous class | 4.1(6.1) |
| Packing group | II |
| Pictograms |    |
| Signal word | DANGER |
| Hazard statements | H228-H301-H315-H-319-H335 |
| Precautionary statements | P210-P240-P241-P242-P243-P261-P264-P270-P271-P280 |
| Transport description | Flammable solid, toxic, organic, n.o.s. (Triphenylborane) |
| In TSCA registry | No (sold for research and development usage only) |
