CAS Number 126970-21-6
For more details check the specification page: Tris(isopropylcyclopentadienyl)gadolinium(III)
Chemical identifiers
| Linear formula | C24H33Gd |
| Pubchem CID | 73411059 |
| SMILES | CC(C)C1=C(CC=C1)[Gd](C2=C(C=CC2)C(C)C)C3=C(C=CC3)C(C)C |
| IUPAC Name | cyclopenta-1,3-diene;gadolinium(3+) |
| InchI Identifier | InChI=1S/3C5H5.Gd/c3*1-2-4-5-3-1;/h3*1-3H,4H2;/q3*-1;+3 |
| InchI Key | WPVCUPCREAIUBK-UHFFFAOYSA-N |
Safety information
| Signal word | WARNING |
| Pictograms |  |
| Hazard statements | H315, H319, H335 |
| Precautionary statements | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, P501 |
| UN | 1325 |
| Transport description | FLAMMABLE SOLIDS, ORGANIC, N.O.S. |
| Hazardous class | 4.1 |
| Packing group | II |
| In TSCA registry | No (sold for research and development usage only) |
