CAS Number 1271-24-5
For more details check the specification page: Bis(cyclopentadienyl)chromium(II)
Chemical identifiers
| Linear formula | Cr(C5H5)2 |
| Pubchem CID | 79154 |
| SMILES | [Cr].[CH]1[CH][CH][CH][CH]1.[CH]2[CH][CH][CH][CH]2 |
| IUPAC Name | chromium(2+);cyclopenta-1,3-diene |
| InchI Identifier | InChI=1S/2C5H5.Cr/c2*1-2-4-5-3-1;/h2*1-5H;/q2*-1;+2 |
| InchI Key | TYYBBNOTQFVVKN-UHFFFAOYSA-N |
Safety information
| Signal word | WARNING |
| Pictograms | |
| Hazard statements | H302, H312, H315, H319, H332, H335 |
| Precautionary statements | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P312, P321, P322, P330, P332+P313, P337+P313, P362, P363, P403+P233, P405, P501 |
| UN | NOT REGULATED |
| In TSCA registry | Yes |

