CAS Number 1284-72-6
For more details check the specification page: Bis(cyclopentadienyl)magnesium
Chemical identifiers
| Linear formula | Mg(C5H5)2 |
| Pubchem CID | 24942211 |
| SMILES | [CH-]1C=CC=C1.[CH-]1C=CC=C1.[Mg+2] |
| IUPAC Name | magnesium; cyclopenta-1,3-diene |
| InchI Identifier | InChI=1S/2C5H5.Mg/c2*1-2-4-5-3-1;/h2*1-5H;/q2*-1;+2 |
| InchI Key | WGESBNRUPISICS-UHFFFAOYSA-N |
Safety information
| Signal word | DANGER |
| Pictograms | |
| Hazard statements | H228, H250, H260, H314, H318, H335 |
| Precautionary statements | P210, P222, P223, P231+P232, P240, P241, P260, P261, P264, P271, P280, P301+P330+P331, P302+P334, P303+P361+P353, P304+P340, P305+P351+P338, P310, P312, P321, P335+P334, P363, P370+P378, P402+P404, P403+P233, P405, P422, P501 |
| UN | 3393 |
| Transport description | ORGANOMETALLIC SUBSTANCE, SOLID, PYROPHORIC, WATER-REACTIVE (BIS(CYCLOPENTADIENYL)MAGNESIUM(II)) |
| Hazardous class | 4.2(4.3) |
| Packing group | I |
| In TSCA registry | Yes |
| Flash point | 13.9±13.0C |

