CAS Number 13154-24-0
For more details check the specification page: Triisopropylsilyl chloride
Chemical identifiers
| Linear formula | [(CH3)2CH]3SiCl |
| Pubchem CID | 139400 |
| SMILES | Cl[Si](C(C)C)(C(C)C)C(C)C |
| IUPAC Name | chloro-tri(propan-2-yl)silane |
| InchI Identifier | InChI=1S/C9H21ClSi/c1-7(2)11(10,8(3)4)9(5)6/h7-9H,1-6H3 |
| InchI Key | KQIADDMXRMTWHZ-UHFFFAOYSA-N |
Safety information
| Signal word | DANGER |
| Pictograms | |
| Hazard statements | H227, H314 |
| Precautionary statements | P210, P260, P264, P280, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P363, P370+P378, P403+P235, P405, P501 |
| UN | 2987 |
| Transport description | CHLOROSILANES, CORROSIVE, N.O.S. |
| Hazardous class | 8 |
| Packing group | II |
| In TSCA registry | No (sold for research and development usage only) |
| Flash point | 64C |

