CAS Number 14090-94-9
Product CAS Number 14090-94-9 has been discontinued.
For more details check the specification page: Tetraphenylantimony(V) methoxide
Chemical identifiers
| Linear formula | (C6H5)4SbOCH3 |
| Pubchem CID | 57348300 |
| SMILES | C[O-].C1=CC=C(C=C1)[Sb+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
| IUPAC Name | methanolate;tetraphenylstibanium |
| InchI Identifier | InChI=1S/4C6H5.CH3O.Sb/c4*1-2-4-6-5-3-1;1-2;/h4*1-5H;1H3;/q;;;;-1;+1 |
| InchI Key | ITTUBOUUCYWGCV-UHFFFAOYSA-N |
Safety information
| Signal word | WARNING |
| Pictograms | |
| Hazard statements | H302, H332, H411 |
| Precautionary statements | P261, P264, P270, P271, P273, P301+P312, P304+P312, P304+P340, P312, P330, P391, P501 |
| UN | 3077 |
| Transport description | ENVIRONMENTALLY HAZARDOUS SUBSTANCE, SOLID, NOS (Tetraphenylantimony (V) bromide) |
| Hazardous class | 9 |
| Packing group | III |
| In TSCA registry | No (sold for research and development usage only) |

