CAS Number 14481-08-4
For more details check the specification page: NIckel (II) 2,2,6,6-tetramethyl-3,5-heptanedionate
Chemical identifiers
| Linear formula | Ni(C11H19O2)2 |
| Pubchem CID | 6432429 |
| SMILES | [Ni+2].[O-]C(=C/C(=O)C(C)(C)C)C(C)(C)C.[O-]C(=C/C(=O)C(C)(C)C)C(C)(C)C |
| IUPAC Name | nickel(2+); (Z)-2,2,6,6-tetramethyl-5-oxohept-3-en-3-olate |
| InchI Identifier | InChI=1S/2C11H20O2.Ni/c2*1-10(2,3)8(12)7-9(13)11(4,5)6;/h2*7,12H,1-6H3;/q;;+2/p-2/b2*8-7-; |
| InchI Key | PIIJAZNTPALBJL-ATMONBRVSA-L |
Safety information
| Signal word | DANGER |
| Pictograms | |
| Hazard statements | H302, H312, H317, H332, H350 |
| Precautionary statements | P203, P261, P264, P270, P271, P272, P280, P301+P317, P302+P352, P304+P340, P317, P318, P330, P333+P317, P362+P364, P405, P501 |
| UN | 3383 |
| In TSCA registry | No (sold for research and development usage only) |

