CAS Number 151625-26-2
For more details check the specification page: 1,2-Bis(diisopropylamino)disilane
Chemical identifiers
| Linear formula | C12H32N2Si2 |
| SMILES | N([SiH2][SiH2]N(C(C)C)C(C)C)(C(C)C)C(C)C |
| InchI Identifier | InChI=1S/C12H32N2Si2/c1-9(2)13(10(3)4)15-16-14(11(5)6)12(7)8/h9-12H,15-16H2,1-8H3 |
| InchI Key | SHJLMBCQMMQSAA-UHFFFAOYSA-N |
Safety Information
| Signal word | DANGER |
| Pictograms |   |
| Hazard statements | H225, H261, H314, H318, H335 |
| Precautionary statements | P210, P223, P231 + P232, P233, P240, P241, P242, P243, P260, P264 + P265, P271, P280, P301 + P330 + P331, P302 + P335 + P334, P302 + P361 + P354, P304 + P340, P305 + P354 + P338, P316, P363, P370 + P378, P402 + P404, P403 + P233 + P235, P405, P501 |
| In TSCA registry | No (sold for research and development usage only) |