CAS Number 15280-57-6
  For more details check the specification page: Erbium (III) acetate hydrate
Chemical identifiers
| Linear formula | Er(OOCCH3)3·XH2O | 
| Pubchem CID | 168385 | 
| SMILES | [Er](OC(=O)C)(OC(=O)C)OC(=O)C | 
| IUPAC Name | erbium(3+) triacetate | 
| InchI Identifier | InChI=1S/3C2H4O2.Er/c3*1-2(3)4;/h3*1H3,(H,3,4);/q;;;+3/p-3 | 
| InchI Key | DBUHPIKTDUMWTR-UHFFFAOYSA-K | 
Safety information
| Signal word | WARNING | 
| Pictograms | |
| Hazard statements | H315, H319, H335 | 
| Precautionary statements | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, P501 | 
| UN | 1325 | 
| Transport description | FLAMMABLE SOLID, ORGANIC, N.O.S. (1,4-DIAZABICYCLOOCTANE) | 
| Hazardous class | 4.1 | 
| Packing group | II | 
| In TSCA registry | No (sold for research and development usage only) | 

 
  
 