CAS Number 15573-38-3
For more details check the specification page: Tris(trimethylsilyl)phosphine
Chemical identifiers
| Linear formula | [(CH3)3Si]3P |
| Pubchem CID | 272683 |
| SMILES | P([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| IUPAC Name | tris(trimethylsilyl)phosphane |
| InchI Identifier | InChI=1S/C9H27PSi3/c1-11(2,3)10(12(4,5)6)13(7,8)9/h1-9H3 |
| InchI Key | OUMZKMRZMVDEOF-UHFFFAOYSA-N |
Safety information
| Signal word | DANGER |
| Pictograms | |
| Hazard statements | H250, H261, H315, H319, H335 |
| Precautionary statements | P210, P222, P223, P231+P232, P261, P264, P271, P280, P302+P334, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P335+P334, P337+P313, P362, P370+P378, P402+P404, P403+P233, P405, P422, P501 |
| UN | 2845 |
| Transport description | FLAMMABLE LIQUIDS, N.O.S. |
| Hazardous class | 4.2 |
| Packing group | I |
| In TSCA registry | No (sold for research and development usage only) |

