CAS Number 16941-12-1
For more details check the specification page: Chloroplatinic Acid, Pt 40%
Chemical identifiers
| Linear formula | H2PtCl6 |
| Pubchem CID | 61859 |
| SMILES | [H+].[H+].Cl[Pt-2](Cl)(Cl)(Cl)(Cl)Cl |
| IUPAC Name | hexachloro platinum(2-); hydron |
| InchI Identifier | InChI=1S/6ClH.Pt/h6*1H;/q;;;;;;+4/p-4 |
| InchI Key | GBFHNZZOZWQQPA-UHFFFAOYSA-J |
Safety information
| Signal word | DANGER |
| Pictograms | |
| Hazard statements | H301, H314, H318, H334 |
| Precautionary statements | P260, P261, P264, P270, P280, P285, P301+P310, P301+P330+P331, P303+P361+P353, P304+P340, P304+P341, P305+P351+P338, P310, P321, P330, P342+P311, P363, P405, P501 |
| UN | 2507 |
| Transport description | Chloroplatinic acid, SOLID |
| Hazardous class | 8 |
| Packing group | III |
| In TSCA registry | No (sold for research and development usage only) |

