CAS Number 170717-12-1
For more details check the specification page: Bis(2,2,6,6-tetrametyl -3,5-heptanedionato)barium bis(phenanthroline)
Chemical identifiers
| Linear formula | BaC46H54N4O4 |
| SMILES | [BaH2].C1cnc2c(c1)ccc3ncccc23 |
Safety information
| Signal word | DANGER |
| Pictograms |   |
| Hazard statements | H301, H311, H315, H319, H331, H335 |
| Precautionary statements | P261, P264, P270, P271, P280, P301+P310, P302+P352, P304+P340, P305+P351+P338, P311, P312, P321, P322, P330, P332+P313, P337+P313, P361, P362, P363, P403+P233, P405, P501 |
| UN | 1564 |
| Transport description | Barium compound, n.o.s. (Bis(1,10-phenanthroline)bis(2,2,6,6-tetrametyl-3,5-heptanedionato)barium) |
| Hazardous class | 6.1 |
| Packing group | II |
| In TSCA registry | No (sold for research and development usage only) |
