CAS Number 19962-12-0
For more details check the specification page: Tetrakis(diethylamino)hafnium(IV)
Chemical identifiers
| Linear formula | [(CH2CH3)2N]4Hf |
| Pubchem CID | 140612 |
| SMILES | CCN(CC)[Hf](N(CC)CC)(N(CC)CC)N(CC)CC |
| IUPAC Name | diethylazanide; hafnium(4+) |
| InchI Identifier | InChI=1S/4C4H10N.Hf/c4*1-3-5-4-2;/h4*3-4H2,1-2H3;/q4*-1;+4 |
| InchI Key | VBCSQFQVDXIOJL-UHFFFAOYSA-N |
Safety information
| Signal word | DANGER |
| Pictograms | |
| Hazard statements | H225, H261, H315, H319, H335 |
| Precautionary statements | P210, P223, P231+P232, P233, P240, P241, P242, P243, P261, P264, P271, P280, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P312, P321, P332+P313, P335+P334, P337+P313, P362, P370+P378, P402+P404, P403+P233, P403+P235, P405, P501 |
| UN | 3398 |
| Transport description | ORGANOMETALLIC SUBSTANCE, LIQUID, WATER-REACTIVE (Tetrakis(diethylamido)hafnium(IV)) |
| Hazardous class | 4.3 |
| Packing group | II |
| In TSCA registry | No (sold for research and development usage only) |
| Flash point | 10C |

