CAS Number 19999-87-2
For more details check the specification page: Bis(tricyclohexylphosphine)nickel(II) chloride
Chemical identifiers
| Linear formula | [(C6H11)3P]2NiCl2 |
| Pubchem CID | 11039739 |
| SMILES | [Ni](Cl)Cl.P(C1CCCCC1)(C2CCCCC2)C3CCCCC3.P(C4CCCCC4)(C5CCCCC5)C6CCCCC6 |
| IUPAC Name | dichloronickel; tricyclohexylphosphane |
| InchI Identifier | InChI=1S/2C18H33P.2ClH.Ni/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h2*16-18H,1-15H2;2*1H;/q;;;;+2/p-2 |
| InchI Key | YOCBOYPGZVFUCQ-UHFFFAOYSA-L |
Safety information
| UN | NOT REGULATED |
| In TSCA registry | No (sold for research and development usage only) |

