CAS Number 20219-33-4
For more details check the specification page: Tetraetoxytantalum acetylacetonate
Chemical identifiers
| Linear formula | Ta(OC2H5)4(CH3COCHCOCH3) |
| Pubchem CID | 4643317 |
| SMILES | CCO.CCO.CCO.CCO.CC(=CC(=O)C)O.[Ta] |
| IUPAC Name | ethanol; (Z)-4-hydroxypent-3-en-2-one; tantalum |
| InchI Identifier | InChI=1S/C5H8O2.4C2H6O.Ta/c1-4(6)3-5(2)7;4*1-2-3;/h3,6H,1-2H3;4*3H,2H2,1H3;/b4-3-;;;;; |
| InchI Key | YMZNJFSVFJDLIR-GLUPTGNJSA-N |
Safety information
| Signal word | DANGER |
| Pictograms | |
| Hazard statements | H228, H315, H319, H335 |
| Precautionary statements | P210, P240, P241, P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P370+P378, P403+P233, P405, P501 |
| UN | 1325 |
| Transport description | FLAMMABLE SOLIDS, ORGANIC, N.O.S. (tantalum(V)tetraethoxy-acetylacetonate) |
| Hazardous class | 4.1 |
| Packing group | II |
| In TSCA registry | No (sold for research and development usage only) |

