CAS Number 210758-43-3
For more details check the specification page: Bis(n-propyltetramethylcyclopentadienyl)barium
Chemical identifiers
| Linear formula | Ba[(C3H7)(CH3)4C5]2 |
| Pubchem CID | 71434150 |
| SMILES | CCCC1=[C-]C(C(=C1C)C)(C)C.CCCC1=[C-]C(C(=C1C)C)(C)C.[Ba+2] |
| IUPAC Name | barium(2+);1,2,5,5-tetramethyl-3-propylcyclopenta-1,3-diene |
| InchI Identifier | InChI=1S/2C12H19.Ba/c2*1-6-7-11-8-12(4,5)10(3)9(11)2;/h2*6-7H2,1-5H3;/q2*-1;+2 |
| InchI Key | FISZVUOZXHFZDA-UHFFFAOYSA-N |
Safety information
| Signal word | WARNING |
| Pictograms | |
| Hazard statements | H301, H311, H319, H331, H335 |
| Precautionary statements | P264, P270, P301+P312, P330, P501 |
| UN | 1564 |
| Transport description | BARIUM COMPOUND, N.O.S. (Bis(n-propyltetramethylcyclopentadienyl)barium) |
| Hazardous class | 6.1 |
| Packing group | II |
| In TSCA registry | No (sold for research and development usage only) |

