CAS Number 2622-14-2
For more details check the specification page: Tricyclohexylphosphine
Chemical identifiers
| Linear formula | (C6H11)3P |
| Pubchem CID | 75806 |
| SMILES | P(C1CCCCC1)(C2CCCCC2)C3CCCCC3 |
| IUPAC Name | tricyclohexylphosphane |
| InchI Identifier | InChI=1S/C18H33P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h16-18H,1-15H2 |
| InchI Key | WLPUWLXVBWGYMZ-UHFFFAOYSA-N |
Safety information
| Signal word | WARNING |
| Pictograms | |
| Hazard statements | H315, H319, H335 |
| Precautionary statements | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, P501 |
| UN | NOT REGULATED |
| In TSCA registry | Yes |

