CAS Number 26472-00-4
For more details check the specification page: Methylcyclopentadiene dimer
Chemical identifiers
| Linear formula | C12H16 |
| Pubchem CID | 3437714 |
| SMILES | CC1=CC2C(C1)C3CC2C(C)=C3 |
| IUPAC Name | 4,9-dimethyltricyclo[5.2.1.02,6]deca-3,8-diene |
| InchI Identifier | InChI=1S/C12H16/c1-7-3-11-9-5-8(2)10(6-9)12(11)4-7/h4-5,9-12H,3,6H2,1-2H3 |
| InchI Key | IYQYZZHQSZMZIG-UHFFFAOYSA-N |
Safety information
| Signal word | DANGER |
| Pictograms | |
| Hazard statements | H340, H350 |
| Precautionary statements | P201, P202, P281, P308+P313, P405, P501 |
| UN | 3295 |
| Transport description | HYDROCARBONS, LIQUID, N.O.S. (methylcyclopentadiene dimer) |
| Hazardous class | 3 |
| Packing group | III |
| In TSCA registry | Yes |
| Flash point | 31.8C |

