CAS Number 27804-64-4
For more details check the specification page: Bis(diethylamino)silane
Chemical identifiers
| Linear formula | SiH2[N(CH2CH3)2]2 |
| Pubchem CID | 14908161 |
| SMILES | CCN(CC)[Si]N(CC)CC |
| IUPAC Name | N-(diethylaminosilyl)-N-ethylethanamine |
| InchI Identifier | InChI=1S/C8H22N2Si/c1-5-9(6-2)11-10(7-3)8-4/h5-8,11H2,1-4H3 |
| InchI Key | OWKFQWAGPHVFRF-UHFFFAOYSA-N |
Safety information
| Signal word | DANGER |
| Pictograms | |
| Hazard statements | H226, H261, H302, H312, H314, H318, H332, H335 |
| Precautionary statements | P210, P223, P231+P232, P233, P240, P241, P242, P243, P260, P261, P264, P270, P271, P280, P301+P312, P301+P330+P331, P302+P352, P303+P361+P353, P304+P312, P304+P340, P305+P351+P338, P310, P312, P321, P322, P330, P335+P334, P363, P370+P378, P402+P404, P403+P233, P403+P235, P405, P501 |
| UN | 3399 |
| Transport description | ORGANOMETALLIC SUBSTANCE, LIQUID, WATER-REACTIVE, FLAMMABLE, N.O.S. (bis(diethylamino)silane) |
| Hazardous class | 4.3(3) |
| Packing group | II |
| In TSCA registry | No (sold for research and development usage only) |
| Flash point | 30C |

