CAS Number 32673-25-9
Product CAS Number 32673-25-9 has been discontinued.
For more details check the specification page: Di-tert-butylphenylphosphine
Chemical identifiers
| Linear formula | C14H23P |
| Pubchem CID | 316378 |
| SMILES | P(C(C)(C)C)(C(C)(C)C)C1=CC=CC=C1 |
| IUPAC Name | ditert-butyl(phenyl)phosphane |
| InchI Identifier | InChI=1S/C14H23P/c1-13(2,3)15(14(4,5)6)12-10-8-7-9-11-12/h7-11H,1-6H3 |
| InchI Key | XOJNEFQLMRCOMS-UHFFFAOYSA-N |
Safety information
| Signal word | DANGER |
| Pictograms | |
| Hazard statements | H250, H315, H319, H335, H413 |
| Precautionary statements | P210, P222, P261, P264, P271, P273, P280, P302+P334, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P370+P378, P403+P233, P405, P422, P501 |
| UN | 2845 |
| Transport description | PYROPHORIC LIQUID, ORGANIC, N.O.S. (Di-tertbutylphenylphosphine) |
| Hazardous class | 4.2 |
| Packing group | I |
| In TSCA registry | No (sold for research and development usage only) |

