CAS Number 39470-11-6
For more details check the specification page: Tris(methylcyclopentadienyl)gadolinium
Chemical identifiers
| Linear formula | Gd(C6H7)3 |
| SMILES | CC1=C(CC=C1)[Gd](C2=C(C)C=CC2)C3=C(C)C=CC3 |
Safety information
| Signal word | DANGER |
| Pictograms |   |
| Hazard statements | H228, H315, H320, H335 |
| Precautionary statements | P210, P240, P241, P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P370+P378, P403+P233, P405, P501 |
| UN | 1325 |
| Transport description | FLAMMABLE SOLID, ORGANIC, N.O.S. |
| Hazardous class | 4.1 |
| Packing group | II |
| In TSCA registry | No (sold for research and development usage only) |
