CAS Number 7688-25-7
For more details check the specification page: 1,4-Bis(diphenylphosphino)butane
Chemical identifiers
| Linear formula | (C6H5)2P(CH2)4P(C6H5)2 |
| Pubchem CID | 82124 |
| SMILES | P(C1=CC=CC=C1)(C2=CC=CC=C2)CCCCP(C3=CC=CC=C3)C4=CC=CC=C4 |
| IUPAC Name | 4-diphenylphosphanylbutyl(diphenyl)phosphane |
| InchI Identifier | InChI=1S/C28H28P2/c1-5-15-25(16-6-1)29(26-17-7-2-8-18-26)23-13-14-24-30(27-19-9-3-10-20-27)28-21-11-4-12-22-28/h1-12,15-22H,13-14,23-24H2 |
| InchI Key | BCJVBDBJSMFBRW-UHFFFAOYSA-N |
Safety information
| Signal word | WARNING |
| Pictograms | |
| Hazard statements | H315, H319, H413 |
| Precautionary statements | P264, P273, P280, P302+P352, P305+P351+P338, P321, P332+P313, P337+P313, P362, P501 |
| UN | NOT REGULATED |
| In TSCA registry | Yes |

