CAS Number 82495-67-8
For more details check the specification page:Chemical identifiers
Linear formula | C6H4Cl4P2 |
Pubchem CID | 3316562 |
SMILES | ClP(Cl)C1=C(P(Cl)Cl)C=CC=C1 |
IUPAC Name | dichloro-(2-dichlorophosphanylphenyl)phosphane |
InchI Identifier | InChI=1S/C6H4Cl4P2/c7-11(8)5-3-1-2-4-6(5)12(9)10/h1-4H |
InchI Key | IGYHSFVSIYJSML-UHFFFAOYSA-N |
Safety information
Signal word | DANGER |
Pictograms | |
Hazard statements | H314, H318 |
Precautionary statements | P260, P264, P280, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P363, P405, P501 |
UN | 3265 |
Transport description | CORROSIVE LIQUID, ACIDIC, ORGANIC, N.O.S. (1,2-Bis(dichlorophosphino)benzene) |
Hazardous class | 8 |
Packing group | II |
In TSCA registry | No (sold for research and development usage only) |
Flash point | >110C |