CAS No. 942311-35-5
For more details check the specification page: Nickel(II) 1-dimethylamino-2-methyl-2-butoxide
Chemical identifiers
| Linear formula | C14H32N2O2Ni |
| Pubchem CID | 89558561 |
| IUPAC Name | 1-(dimethylamino)-2-methylbutan-2-olate;nickel(2+) |
| SMILES | CCC(C)(CN(C)C)[O-].CCC(C)(CN(C)C)[O-].[Ni+2] |
| InchI Identifier | InChI=1S/2C7H16NO.Ni/c2*1-5-7(2,9)6-8(3)4;/h2*5-6H2,1-4H3;/q2*-1;+2 |
| InchI Key | LECAMOYWYJUYIH-UHFFFAOYSA-N |
Safety information
| UN | 3398 |
| Hazardous class | 4.3 |
| Packing group | II |
| Pictograms |   |
| Signal word | DANGER |
| Hazard statements | H315-H319-H334-H335-H372 |
| Precautionary statements | P260-P264-P270-P271-P280-P285-P302 + P352-P304 + P340-P305 + P351 + P338-P311 + P342-P312-P314-P332 + P313-P337 + P313-P362 |
| Transport description | Organometallic substance, liquid, water-reactive, (Nickel(II) 1- dimethylamino-2- methyl-2-butoxide) |
| In TSCA registry | No (research and development usage only) |
